C19H28N3O7P-2 — CID 118987914
(2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate (PubChem CID 118987914) has the molecular formula C19H28N3O7P-2 and a molecular weight of 441.42 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate.
| Compound Name | (2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 118987914 |
| Molecular Formula | C19H28N3O7P-2 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate |
| SMILES | CC[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C19H30N3O7P/c1-4-15(17(23)21-16(18(24)25)10-13(2)3)22-30(27,28)12-20-19(26)29-11-14-8-6-5-7-9-14/h5-9,13,15-16H,4,10-12H2,1-3H3,(H,20,26)(H,21,23)(H,24,25)(H2,22,27,28)/p-2/t15-,16-/m0/s1 |
| InChIKey | VARZJGDIWXKXFN-HOTGVXAUSA-L |
| XLogP | 0.07 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|