C17H24Li2N3O7P — CID 71458968
dilithium;2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]acetate (PubChem CID 71458968) has the molecular formula C17H24Li2N3O7P and a molecular weight of 427.25 g/mol. Its IUPAC name is dilithium;2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]acetate.
| Compound Name | dilithium;2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 71458968 |
| Molecular Formula | C17H24Li2N3O7P |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | dilithium;2-[[(2S)-4-methyl-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]pentanoyl]amino]acetate |
| SMILES | CC(C)C[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)NCC(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C17H26N3O7P.2Li/c1-12(2)8-14(16(23)18-9-15(21)22)20-28(25,26)11-19-17(24)27-10-13-6-4-3-5-7-13;;/h3-7,12,14H,8-11H2,1-2H3,(H,18,23)(H,19,24)(H,21,22)(H2,20,25,26);;/q;2*+1/p-2/t14-;;/m0../s1 |
| InChIKey | QZQXIROMKJZIPC-UTLKBRERSA-L |
| XLogP | -6.70 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | -6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|