C14H18Li2N3O7P — CID 118731700
dilithium;2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]propanoyl]amino]acetate (PubChem CID 118731700) has the molecular formula C14H18Li2N3O7P and a molecular weight of 385.17 g/mol. Its IUPAC name is dilithium;2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]propanoyl]amino]acetate.
| Compound Name | dilithium;2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 118731700 |
| Molecular Formula | C14H18Li2N3O7P |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | dilithium;2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]propanoyl]amino]acetate |
| SMILES | C[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)NCC(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C14H20N3O7P.2Li/c1-10(13(20)15-7-12(18)19)17-25(22,23)9-16-14(21)24-8-11-5-3-2-4-6-11;;/h2-6,10H,7-9H2,1H3,(H,15,20)(H,16,21)(H,18,19)(H2,17,22,23);;/q;2*+1/p-2/t10-;;/m0../s1 |
| InChIKey | UGSMGYNPOYEWNI-XRIOVQLTSA-L |
| XLogP | -7.72 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | -7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|