C19H28Li2N3O7P — CID 118731664
dilithium;(2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate (PubChem CID 118731664) has the molecular formula C19H28Li2N3O7P and a molecular weight of 455.30 g/mol. Its IUPAC name is dilithium;(2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate.
| Compound Name | dilithium;(2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 118731664 |
| Molecular Formula | C19H28Li2N3O7P |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | dilithium;(2S)-4-methyl-2-[[(2S)-2-[[oxido(phenylmethoxycarbonylaminomethyl)phosphoryl]amino]butanoyl]amino]pentanoate |
| SMILES | CC[C@H](NP(=O)([O-])CNC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C19H30N3O7P.2Li/c1-4-15(17(23)21-16(18(24)25)10-13(2)3)22-30(27,28)12-20-19(26)29-11-14-8-6-5-7-9-14;;/h5-9,13,15-16H,4,10-12H2,1-3H3,(H,20,26)(H,21,23)(H,24,25)(H2,22,27,28);;/q;2*+1/p-2/t15-,16-;;/m0../s1 |
| InChIKey | RPEFPXNKWPDHQA-SXBSVMRRSA-L |
| XLogP | -5.92 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | -5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|