C18H29N2O5P — CID 54451073
(2S)-2-[[(2S)-2-[[ethoxy(methyl)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 54451073) has the molecular formula C18H29N2O5P and a molecular weight of 384.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[ethoxy(methyl)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[ethoxy(methyl)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 54451073 |
| Molecular Formula | C18H29N2O5P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[ethoxy(methyl)phosphoryl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCOP(C)(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C18H29N2O5P/c1-5-25-26(4,24)20-15(12-14-9-7-6-8-10-14)17(21)19-16(18(22)23)11-13(2)3/h6-10,13,15-16H,5,11-12H2,1-4H3,(H,19,21)(H,20,24)(H,22,23)/t15-,16-,26?/m0/s1 |
| InChIKey | WUZZGMHXJCWIBJ-ZIZWBSLWSA-N |
| XLogP | 2.66 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|