C26H42N5O10P — CID 101157170
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(dimethoxyphosphorylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]-4-methylpentanoic acid (PubChem CID 101157170) has the molecular formula C26H42N5O10P and a molecular weight of 615.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(dimethoxyphosphorylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(dimethoxyphosphorylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 101157170 |
| Molecular Formula | C26H42N5O10P |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(dimethoxyphosphorylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |
| SMILES | COP(=O)(N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O)OC |
| InChI | InChI=1S/C26H42N5O10P/c1-15(2)12-20(26(37)38)30-23(34)17(4)27-24(35)19(13-18-10-8-7-9-11-18)29-22(33)16(3)28-25(36)21(14-32)31-42(39,40-5)41-6/h7-11,15-17,19-21,32H,12-14H2,1-6H3,(H,27,35)(H,28,36)(H,29,33)(H,30,34)(H,31,39)(H,37,38)/t16-,17-,19-,20-,21-/m0/s1 |
| InChIKey | GUTTUMOKSCXCBH-XYYCENQHSA-N |
| XLogP | -0.31 |
| TPSA | 221.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|