C18H29N2O6P — CID 10916375
(2S)-2-[[(2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 10916375) has the molecular formula C18H29N2O6P and a molecular weight of 400.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10916375 |
| Molecular Formula | C18H29N2O6P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | CC(C)OP(=O)(N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)O)OC(C)C |
| InChI | InChI=1S/C18H29N2O6P/c1-12(2)25-27(24,26-13(3)4)20-16(11-15-9-7-6-8-10-15)17(21)19-14(5)18(22)23/h6-10,12-14,16H,11H2,1-5H3,(H,19,21)(H,20,24)(H,22,23)/t14-,16-/m0/s1 |
| InChIKey | KTRBHCVXMWJVNW-HOCLYGCPSA-N |
| XLogP | 2.73 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|