C15H24NO5P — CID 11484292
(2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoic acid (PubChem CID 11484292) has the molecular formula C15H24NO5P and a molecular weight of 329.33 g/mol. Its IUPAC name is (2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11484292 |
| Molecular Formula | C15H24NO5P |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-2-[di(propan-2-yloxy)phosphorylamino]-3-phenylpropanoic acid |
| SMILES | CC(C)OP(=O)(N[C@@H](Cc1ccccc1)C(=O)O)OC(C)C |
| InChI | InChI=1S/C15H24NO5P/c1-11(2)20-22(19,21-12(3)4)16-14(15(17)18)10-13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3,(H,16,19)(H,17,18)/t14-/m0/s1 |
| InChIKey | RGSFXCVQFSSWKN-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|