C15H24NO6P — CID 15224756
2-[di(propan-2-yloxy)phosphorylamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 15224756) has the molecular formula C15H24NO6P and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-[di(propan-2-yloxy)phosphorylamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[di(propan-2-yloxy)phosphorylamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 15224756 |
| Molecular Formula | C15H24NO6P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[di(propan-2-yloxy)phosphorylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)OP(=O)(NC(Cc1ccc(O)cc1)C(=O)O)OC(C)C |
| InChI | InChI=1S/C15H24NO6P/c1-10(2)21-23(20,22-11(3)4)16-14(15(18)19)9-12-5-7-13(17)8-6-12/h5-8,10-11,14,17H,9H2,1-4H3,(H,16,20)(H,18,19) |
| InChIKey | NMZNFLKKGZPCKE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|