C18H23N2O9P — CID 67405469
2-amino-3-(4-hydroxyphenyl)propanoic acid;3-(4-hydroxyphenyl)-2-(phosphonoamino)propanoic acid (PubChem CID 67405469) has the molecular formula C18H23N2O9P and a molecular weight of 442.36 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;3-(4-hydroxyphenyl)-2-(phosphonoamino)propanoic acid.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;3-(4-hydroxyphenyl)-2-(phosphonoamino)propanoic acid |
|---|---|
| PubChem CID | 67405469 |
| Molecular Formula | C18H23N2O9P |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;3-(4-hydroxyphenyl)-2-(phosphonoamino)propanoic acid |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)O.O=C(O)C(Cc1ccc(O)cc1)NP(=O)(O)O |
| InChI | InChI=1S/C9H12NO6P.C9H11NO3/c11-7-3-1-6(2-4-7)5-8(9(12)13)10-17(14,15)16;10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5H2,(H,12,13)(H3,10,14,15,16);1-4,8,11H,5,10H2,(H,12,13) |
| InChIKey | DNOACHSHYFFHNX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 210.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|