C9H12NO2P — CID 70012014
(2R)-3-phenyl-2-(phosphanylamino)propanoic acid (PubChem CID 70012014) has the molecular formula C9H12NO2P and a molecular weight of 197.17 g/mol. Its IUPAC name is (2R)-3-phenyl-2-(phosphanylamino)propanoic acid.
| Compound Name | (2R)-3-phenyl-2-(phosphanylamino)propanoic acid |
|---|---|
| PubChem CID | 70012014 |
| Molecular Formula | C9H12NO2P |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (2R)-3-phenyl-2-(phosphanylamino)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NP |
| InChI | InChI=1S/C9H12NO2P/c11-9(12)8(10-13)6-7-4-2-1-3-5-7/h1-5,8,10H,6,13H2,(H,11,12)/t8-/m1/s1 |
| InChIKey | JZDBURVECWNANC-MRVPVSSYSA-N |
| XLogP | 1.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|