C11H13NO4 — CID 88696539
(2S)-2-[carboxymethyl(deuterio)amino]-3-phenylpropanoic acid (PubChem CID 88696539) has the molecular formula C11H13NO4 and a molecular weight of 224.23 g/mol. Its IUPAC name is (2S)-2-[carboxymethyl(deuterio)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[carboxymethyl(deuterio)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 88696539 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (2S)-2-[carboxymethyl(deuterio)amino]-3-phenylpropanoic acid |
| SMILES | [2H]N(CC(=O)O)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4/c13-10(14)7-12-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9,12H,6-7H2,(H,13,14)(H,15,16)/t9-/m0/s1/i/hD |
| InChIKey | FVQDAMVODWHNOJ-XDACSXLQSA-N |
| XLogP | 0.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |