C20H23ClN2O4 — CID 71819130
(2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride (PubChem CID 71819130) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 71819130 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-3-phenylpropanoic acid;hydrochloride |
| SMILES | Cl.N[C@H](Cc1ccccc1)C(=O)CC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H22N2O4.ClH/c21-16(11-14-7-3-1-4-8-14)18(23)13-19(24)22-17(20(25)26)12-15-9-5-2-6-10-15;/h1-10,16-17H,11-13,21H2,(H,22,24)(H,25,26);1H/t16-,17+;/m1./s1 |
| InChIKey | TYROSYKERZRBRZ-PPPUBMIESA-N |
| XLogP | 1.75 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|