C19H20N2O4 — CID 71819133
(2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetic acid (PubChem CID 71819133) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 71819133 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetic acid |
| SMILES | N[C@H](Cc1ccccc1)C(=O)CC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c20-15(11-13-7-3-1-4-8-13)16(22)12-17(23)21-18(19(24)25)14-9-5-2-6-10-14/h1-10,15,18H,11-12,20H2,(H,21,23)(H,24,25)/t15-,18+/m1/s1 |
| InChIKey | IFXIMUGGDPSTAO-QAPCUYQASA-N |
| XLogP | 1.46 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|