C16H17NO — CID 20792391
3-amino-1,4-diphenylbutan-2-one (PubChem CID 20792391) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-amino-1,4-diphenylbutan-2-one.
| Compound Name | 3-amino-1,4-diphenylbutan-2-one |
|---|---|
| PubChem CID | 20792391 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-amino-1,4-diphenylbutan-2-one |
| SMILES | NC(Cc1ccccc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10,15H,11-12,17H2 |
| InChIKey | USTQWSXTPXSCQL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |