C20H23ClN2O4 — CID 71818996
methyl (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetate;hydrochloride (PubChem CID 71818996) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is methyl (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetate;hydrochloride.
| Compound Name | methyl (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetate;hydrochloride |
|---|---|
| PubChem CID | 71818996 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | methyl (2S)-2-[[(4R)-4-amino-3-oxo-5-phenylpentanoyl]amino]-2-phenylacetate;hydrochloride |
| SMILES | COC(=O)[C@@H](NC(=O)CC(=O)[C@H](N)Cc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H22N2O4.ClH/c1-26-20(25)19(15-10-6-3-7-11-15)22-18(24)13-17(23)16(21)12-14-8-4-2-5-9-14;/h2-11,16,19H,12-13,21H2,1H3,(H,22,24);1H/t16-,19+;/m1./s1 |
| InChIKey | BKDGEJKAQYSGTI-VWJDFLIZSA-N |
| XLogP | 1.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|