C16H16N2O3 — CID 62109189
methyl 2-phenyl-2-[(2-pyridin-4-ylacetyl)amino]acetate (PubChem CID 62109189) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 2-phenyl-2-[(2-pyridin-4-ylacetyl)amino]acetate.
| Compound Name | methyl 2-phenyl-2-[(2-pyridin-4-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 62109189 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 2-phenyl-2-[(2-pyridin-4-ylacetyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)Cc1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O3/c1-21-16(20)15(13-5-3-2-4-6-13)18-14(19)11-12-7-9-17-10-8-12/h2-10,15H,11H2,1H3,(H,18,19) |
| InChIKey | IXLBBEXVZWLGDQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |