C13H20ClNO2 — CID 66836735
(2S)-2-(tert-butylamino)-3-phenylpropanoic acid;hydrochloride (PubChem CID 66836735) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-3-phenylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-(tert-butylamino)-3-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66836735 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-2-(tert-butylamino)-3-phenylpropanoic acid;hydrochloride |
| SMILES | CC(C)(C)N[C@@H](Cc1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-13(2,3)14-11(12(15)16)9-10-7-5-4-6-8-10;/h4-8,11,14H,9H2,1-3H3,(H,15,16);1H/t11-;/m0./s1 |
| InChIKey | YELVQFKPJMJZJE-MERQFXBCSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |