C22H18N2O2 — CID 7723199
(2R)-2-(acridin-9-ylamino)-3-phenylpropanoic acid (PubChem CID 7723199) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2R)-2-(acridin-9-ylamino)-3-phenylpropanoic acid.
| Compound Name | (2R)-2-(acridin-9-ylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 7723199 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2R)-2-(acridin-9-ylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C22H18N2O2/c25-22(26)20(14-15-8-2-1-3-9-15)24-21-16-10-4-6-12-18(16)23-19-13-7-5-11-17(19)21/h1-13,20H,14H2,(H,23,24)(H,25,26)/t20-/m1/s1 |
| InChIKey | LZDIPJARGCCMBS-HXUWFJFHSA-N |
| XLogP | 4.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|