C17H16N2O3 — CID 7722645
(2S,3S)-2-(acridin-9-ylamino)-3-hydroxybutanoic acid (PubChem CID 7722645) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2S,3S)-2-(acridin-9-ylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3S)-2-(acridin-9-ylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 7722645 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2S,3S)-2-(acridin-9-ylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](Nc1c2ccccc2nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H16N2O3/c1-10(20)15(17(21)22)19-16-11-6-2-4-8-13(11)18-14-9-5-3-7-12(14)16/h2-10,15,20H,1H3,(H,18,19)(H,21,22)/t10-,15-/m0/s1 |
| InChIKey | LXFPQDBIOAGAGA-BONVTDFDSA-N |
| XLogP | 2.63 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|