C14H14N2O4 — CID 104964931
(2S,3R)-3-hydroxy-2-(quinoline-5-carbonylamino)butanoic acid (PubChem CID 104964931) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(quinoline-5-carbonylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(quinoline-5-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 104964931 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(quinoline-5-carbonylamino)butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1cccc2ncccc12)C(=O)O |
| InChI | InChI=1S/C14H14N2O4/c1-8(17)12(14(19)20)16-13(18)10-4-2-6-11-9(10)5-3-7-15-11/h2-8,12,17H,1H3,(H,16,18)(H,19,20)/t8-,12+/m1/s1 |
| InChIKey | LWZKXHGDHMIPHI-PELKAZGASA-N |
| XLogP | 0.80 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |