C21H22N2O4 — CID 55725605
N-[1-(3,4,5-trimethoxyphenyl)ethyl]quinoline-5-carboxamide (PubChem CID 55725605) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethyl]quinoline-5-carboxamide.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 55725605 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]quinoline-5-carboxamide |
| SMILES | COc1cc(C(C)NC(=O)c2cccc3ncccc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N2O4/c1-13(14-11-18(25-2)20(27-4)19(12-14)26-3)23-21(24)16-7-5-9-17-15(16)8-6-10-22-17/h5-13H,1-4H3,(H,23,24) |
| InChIKey | AEDCUMCOJLNMMG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |