C21H27NO7 — CID 55714675
2,4,5-trimethoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 55714675) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55714675 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2,4,5-trimethoxy-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(OC)c(C(=O)NC(C)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H27NO7/c1-12(13-8-18(27-5)20(29-7)19(9-13)28-6)22-21(23)14-10-16(25-3)17(26-4)11-15(14)24-2/h8-12H,1-7H3,(H,22,23) |
| InChIKey | LUDYGQTVDYGGKH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |