C14H19NO4 — CID 51346106
N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 51346106) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 51346106 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-6-13(16)15-9(2)10-7-11(17-3)14(19-5)12(8-10)18-4/h6-9H,1H2,2-5H3,(H,15,16) |
| InChIKey | AQLVDSGXPXEGHJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|