C16H18BrNO5 — CID 55709298
5-bromo-N-[1-(3,4,5-trimethoxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 55709298) has the molecular formula C16H18BrNO5 and a molecular weight of 384.23 g/mol. Its IUPAC name is 5-bromo-N-[1-(3,4,5-trimethoxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(3,4,5-trimethoxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55709298 |
| Molecular Formula | C16H18BrNO5 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 5-bromo-N-[1-(3,4,5-trimethoxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | COc1cc(C(C)NC(=O)c2ccc(Br)o2)cc(OC)c1OC |
| InChI | InChI=1S/C16H18BrNO5/c1-9(18-16(19)11-5-6-14(17)23-11)10-7-12(20-2)15(22-4)13(8-10)21-3/h5-9H,1-4H3,(H,18,19) |
| InChIKey | IBRDUTKYFGYVMJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |