C15H19N3O3 — CID 21003866
3-hydroxy-2-[(2-propan-2-ylquinazolin-4-yl)amino]butanoic acid (PubChem CID 21003866) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-hydroxy-2-[(2-propan-2-ylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[(2-propan-2-ylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 21003866 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-hydroxy-2-[(2-propan-2-ylquinazolin-4-yl)amino]butanoic acid |
| SMILES | CC(C)c1nc(NC(C(=O)O)C(C)O)c2ccccc2n1 |
| InChI | InChI=1S/C15H19N3O3/c1-8(2)13-16-11-7-5-4-6-10(11)14(18-13)17-12(9(3)19)15(20)21/h4-9,12,19H,1-3H3,(H,20,21)(H,16,17,18) |
| InChIKey | YXRSVAIWYLPKTP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |