C14H17N3O2 — CID 725448
(2R,3S)-3-methyl-2-(quinazolin-4-ylamino)pentanoic acid (PubChem CID 725448) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-(quinazolin-4-ylamino)pentanoic acid.
| Compound Name | (2R,3S)-3-methyl-2-(quinazolin-4-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 725448 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (2R,3S)-3-methyl-2-(quinazolin-4-ylamino)pentanoic acid |
| SMILES | CC[C@H](C)[C@@H](Nc1ncnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H17N3O2/c1-3-9(2)12(14(18)19)17-13-10-6-4-5-7-11(10)15-8-16-13/h4-9,12H,3H2,1-2H3,(H,18,19)(H,15,16,17)/t9-,12+/m0/s1 |
| InChIKey | BRVOHIWIBWLVIE-JOYOIKCWSA-N |
| XLogP | 2.54 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |