C18H19N3O2S — CID 91964442
3-methyl-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]pentanoic acid (PubChem CID 91964442) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-methyl-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]pentanoic acid.
| Compound Name | 3-methyl-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 91964442 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-methyl-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]pentanoic acid |
| SMILES | CCC(C)C(Nc1nc(-c2cccs2)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H19N3O2S/c1-3-11(2)15(18(22)23)20-16-12-7-4-5-8-13(12)19-17(21-16)14-9-6-10-24-14/h4-11,15H,3H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | MIJYGXYQHZZRRX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |