C18H18N4O2S2 — CID 7606681
(2S)-N-(ethylcarbamoyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide (PubChem CID 7606681) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2S)-N-(ethylcarbamoyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(ethylcarbamoyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7606681 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (2S)-N-(ethylcarbamoyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide |
| SMILES | CCNC(=O)NC(=O)[C@H](C)Sc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C18H18N4O2S2/c1-3-19-18(24)22-16(23)11(2)26-17-12-7-4-5-8-13(12)20-15(21-17)14-9-6-10-25-14/h4-11H,3H2,1-2H3,(H2,19,22,23,24)/t11-/m0/s1 |
| InChIKey | CBNOOTJAJFFYNM-NSHDSACASA-N |
| XLogP | 3.68 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |