C19H20N4O2S2 — CID 7606818
N-[[(2S)-butan-2-yl]carbamoyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide (PubChem CID 7606818) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[[(2S)-butan-2-yl]carbamoyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7606818 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
| SMILES | CC[C@H](C)NC(=O)NC(=O)CSc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C19H20N4O2S2/c1-3-12(2)20-19(25)22-16(24)11-27-18-13-7-4-5-8-14(13)21-17(23-18)15-9-6-10-26-15/h4-10,12H,3,11H2,1-2H3,(H2,20,22,24,25)/t12-/m0/s1 |
| InChIKey | MRPKHKXWRKJPNL-LBPRGKRZSA-N |
| XLogP | 4.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |