C21H14F3N3OS2 — CID 16507539
2-(2-thiophen-2-ylquinazolin-4-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 16507539) has the molecular formula C21H14F3N3OS2 and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylquinazolin-4-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-thiophen-2-ylquinazolin-4-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16507539 |
| Molecular Formula | C21H14F3N3OS2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-(2-thiophen-2-ylquinazolin-4-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc(-c2cccs2)nc2ccccc12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H14F3N3OS2/c22-21(23,24)14-7-2-4-9-16(14)25-18(28)12-30-20-13-6-1-3-8-15(13)26-19(27-20)17-10-5-11-29-17/h1-11H,12H2,(H,25,28) |
| InChIKey | YRINXRREHONTOI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |