C20H17N3OS3 — CID 8949580
N-(2-thiophen-2-ylethyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide (PubChem CID 8949580) has the molecular formula C20H17N3OS3 and a molecular weight of 411.58 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-thiophen-2-ylethyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8949580 |
| Molecular Formula | C20H17N3OS3 |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-(2-thiophen-2-ylethyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc(-c2cccs2)nc2ccccc12)NCCc1cccs1 |
| InChI | InChI=1S/C20H17N3OS3/c24-18(21-10-9-14-5-3-11-25-14)13-27-20-15-6-1-2-7-16(15)22-19(23-20)17-8-4-12-26-17/h1-8,11-12H,9-10,13H2,(H,21,24) |
| InChIKey | JIGHXEURCBDRRX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |