C17H17N3OS2 — CID 7627761
2-(2-methylquinazolin-4-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 7627761) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 2-(2-methylquinazolin-4-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2-methylquinazolin-4-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 7627761 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(2-methylquinazolin-4-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | Cc1nc(SCC(=O)NCCc2cccs2)c2ccccc2n1 |
| InChI | InChI=1S/C17H17N3OS2/c1-12-19-15-7-3-2-6-14(15)17(20-12)23-11-16(21)18-9-8-13-5-4-10-22-13/h2-7,10H,8-9,11H2,1H3,(H,18,21) |
| InChIKey | CQBKJFHDFZIKSV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |