C22H19N3OS2 — CID 1442547
2-(2-benzylquinazolin-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 1442547) has the molecular formula C22H19N3OS2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-(2-benzylquinazolin-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(2-benzylquinazolin-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1442547 |
| Molecular Formula | C22H19N3OS2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-(2-benzylquinazolin-4-yl)sulfanyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSc1nc(Cc2ccccc2)nc2ccccc12)NCc1cccs1 |
| InChI | InChI=1S/C22H19N3OS2/c26-21(23-14-17-9-6-12-27-17)15-28-22-18-10-4-5-11-19(18)24-20(25-22)13-16-7-2-1-3-8-16/h1-12H,13-15H2,(H,23,26) |
| InChIKey | YKHBACBQWFAPBQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |