C17H16N4O2S2 — CID 35502144
2-(3-methylquinoxalin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 35502144) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-(3-methylquinoxalin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 35502144 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | Cc1nc2ccccc2nc1SCC(=O)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H16N4O2S2/c1-11-16(20-14-7-3-2-6-13(14)19-11)25-10-15(22)21-17(23)18-9-12-5-4-8-24-12/h2-8H,9-10H2,1H3,(H2,18,21,22,23) |
| InChIKey | IQFQMRIMFCRFGN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |