C20H22N4OS2 — CID 35503083
2-(3-methylquinoxalin-2-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 35503083) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-(3-methylquinoxalin-2-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 35503083 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-(3-methylquinoxalin-2-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | Cc1nc2ccccc2nc1SCC(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H22N4OS2/c1-15-20(22-18-7-3-2-6-17(18)21-15)27-14-19(25)24-10-8-23(9-11-24)13-16-5-4-12-26-16/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | UIAMOCNEZGRRLG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |