C15H22N6OS2 — CID 38222371
2-(1-propan-2-yltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 38222371) has the molecular formula C15H22N6OS2 and a molecular weight of 366.52 g/mol. Its IUPAC name is 2-(1-propan-2-yltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-propan-2-yltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 38222371 |
| Molecular Formula | C15H22N6OS2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(1-propan-2-yltetrazol-5-yl)sulfanyl-1-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)n1nnnc1SCC(=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H22N6OS2/c1-12(2)21-15(16-17-18-21)24-11-14(22)20-7-5-19(6-8-20)10-13-4-3-9-23-13/h3-4,9,12H,5-8,10-11H2,1-2H3 |
| InChIKey | JCEUHQYHNDGKTP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |