C13H15N5O2S2 — CID 27268140
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide (PubChem CID 27268140) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 27268140 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethylcarbamoyl)acetamide |
| SMILES | Cc1cc(N)nc(SCC(=O)NC(=O)NCc2cccs2)n1 |
| InChI | InChI=1S/C13H15N5O2S2/c1-8-5-10(14)17-13(16-8)22-7-11(19)18-12(20)15-6-9-3-2-4-21-9/h2-5H,6-7H2,1H3,(H2,14,16,17)(H2,15,18,19,20) |
| InChIKey | BZKLJYOSHHSZJM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |