C17H22N4O2S — CID 7144886
N-(3-methylbutylcarbamoyl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide (PubChem CID 7144886) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-(3-methylbutylcarbamoyl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(3-methylbutylcarbamoyl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7144886 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(3-methylbutylcarbamoyl)-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
| SMILES | Cc1nc(SCC(=O)NC(=O)NCCC(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C17H22N4O2S/c1-11(2)8-9-18-17(23)21-15(22)10-24-16-13-6-4-5-7-14(13)19-12(3)20-16/h4-7,11H,8-10H2,1-3H3,(H2,18,21,22,23) |
| InChIKey | UBKCEQIECWDECW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |