C23H27N3OS — CID 7210089
N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]-2-(2-methylquinazolin-4-yl)sulfanylacetamide (PubChem CID 7210089) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]-2-(2-methylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7210089 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]-2-(2-methylquinazolin-4-yl)sulfanylacetamide |
| SMILES | Cc1nc(SCC(=O)N[C@@H](C)c2ccc(CC(C)C)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H27N3OS/c1-15(2)13-18-9-11-19(12-10-18)16(3)24-22(27)14-28-23-20-7-5-6-8-21(20)25-17(4)26-23/h5-12,15-16H,13-14H2,1-4H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | DSIQYZNXVOZPMM-INIZCTEOSA-N |
| XLogP | 5.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |