C13H14N4O2S — CID 7133852
N'-acetyl-2-(2-methylquinazolin-4-yl)sulfanylacetohydrazide (PubChem CID 7133852) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is N'-acetyl-2-(2-methylquinazolin-4-yl)sulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-(2-methylquinazolin-4-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 7133852 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N'-acetyl-2-(2-methylquinazolin-4-yl)sulfanylacetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1nc(C)nc2ccccc12 |
| InChI | InChI=1S/C13H14N4O2S/c1-8-14-11-6-4-3-5-10(11)13(15-8)20-7-12(19)17-16-9(2)18/h3-6H,7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | CVXYYTONZHRJDN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|