C21H17N3OS — CID 7145516
2-(2-methylquinazolin-4-yl)sulfanyl-N-naphthalen-1-ylacetamide (PubChem CID 7145516) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-(2-methylquinazolin-4-yl)sulfanyl-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(2-methylquinazolin-4-yl)sulfanyl-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 7145516 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(2-methylquinazolin-4-yl)sulfanyl-N-naphthalen-1-ylacetamide |
| SMILES | Cc1nc(SCC(=O)Nc2cccc3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C21H17N3OS/c1-14-22-19-11-5-4-10-17(19)21(23-14)26-13-20(25)24-18-12-6-8-15-7-2-3-9-16(15)18/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | GOLSVSJSOOEDTH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |