C19H18BrN3OS — CID 43055140
N-[1-(4-bromophenyl)ethyl]-2-(3-methylquinoxalin-2-yl)sulfanylacetamide (PubChem CID 43055140) has the molecular formula C19H18BrN3OS and a molecular weight of 416.34 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2-(3-methylquinoxalin-2-yl)sulfanylacetamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2-(3-methylquinoxalin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 43055140 |
| Molecular Formula | C19H18BrN3OS |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2-(3-methylquinoxalin-2-yl)sulfanylacetamide |
| SMILES | Cc1nc2ccccc2nc1SCC(=O)NC(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrN3OS/c1-12(14-7-9-15(20)10-8-14)22-18(24)11-25-19-13(2)21-16-5-3-4-6-17(16)23-19/h3-10,12H,11H2,1-2H3,(H,22,24) |
| InChIKey | KWXUZGKKOSFAKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |