C17H18BrNOS — CID 2119755
2-(4-bromo-2-methylphenyl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 2119755) has the molecular formula C17H18BrNOS and a molecular weight of 364.31 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 2119755 |
| Molecular Formula | C17H18BrNOS |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | Cc1cc(Br)ccc1SCC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H18BrNOS/c1-12-10-15(18)8-9-16(12)21-11-17(20)19-13(2)14-6-4-3-5-7-14/h3-10,13H,11H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | GEYPUYJDEBAZEM-CYBMUJFWSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |