C16H17BrN2OS — CID 79519416
2-(2-amino-5-bromophenyl)sulfanyl-N-(1-phenylethyl)acetamide (PubChem CID 79519416) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-(2-amino-5-bromophenyl)sulfanyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 79519416 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CSc1cc(Br)ccc1N)c1ccccc1 |
| InChI | InChI=1S/C16H17BrN2OS/c1-11(12-5-3-2-4-6-12)19-16(20)10-21-15-9-13(17)7-8-14(15)18/h2-9,11H,10,18H2,1H3,(H,19,20) |
| InChIKey | GZQJYAUILDIBPT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|