C16H14BrF3N2OS — CID 55364493
N-[1-(4-bromophenyl)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 55364493) has the molecular formula C16H14BrF3N2OS and a molecular weight of 419.27 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 55364493 |
| Molecular Formula | C16H14BrF3N2OS |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CC(NC(=O)CSc1ccc(C(F)(F)F)cn1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrF3N2OS/c1-10(11-2-5-13(17)6-3-11)22-14(23)9-24-15-7-4-12(8-21-15)16(18,19)20/h2-8,10H,9H2,1H3,(H,22,23) |
| InChIKey | ZLGKURUXOMTGGV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |