C14H19F3N2O2S — CID 111460902
N-(3-hydroxy-4-methylpentyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 111460902) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 111460902 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CC(C)C(O)CCNC(=O)CSc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-9(2)11(20)5-6-18-12(21)8-22-13-4-3-10(7-19-13)14(15,16)17/h3-4,7,9,11,20H,5-6,8H2,1-2H3,(H,18,21) |
| InChIKey | BEMIUMXVTGSSDJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |