C16H22F3NO2 — CID 111461113
N-(3-hydroxy-4-methylpentyl)-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 111461113) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 111461113 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C)C(O)CCNC(=O)CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO2/c1-11(2)14(21)9-10-20-15(22)8-5-12-3-6-13(7-4-12)16(17,18)19/h3-4,6-7,11,14,21H,5,8-10H2,1-2H3,(H,20,22) |
| InChIKey | ZVSQTQAXIGVIMN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |