C17H24F3NO2 — CID 111461371
N-(3-hydroxy-4-methylpentyl)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 111461371) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 111461371 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)C(=O)NCCC(O)C(C)C |
| InChI | InChI=1S/C17H24F3NO2/c1-11(2)15(22)8-9-21-16(23)12(3)10-13-4-6-14(7-5-13)17(18,19)20/h4-7,11-12,15,22H,8-10H2,1-3H3,(H,21,23) |
| InChIKey | WSPMKBPQMMSCLB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |