C15H16F3N3O3 — CID 130342962
(2R)-N-[[(4R)-2,5-dioxoimidazolidin-4-yl]methyl]-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 130342962) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is (2R)-N-[[(4R)-2,5-dioxoimidazolidin-4-yl]methyl]-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-N-[[(4R)-2,5-dioxoimidazolidin-4-yl]methyl]-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 130342962 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2R)-N-[[(4R)-2,5-dioxoimidazolidin-4-yl]methyl]-2-methyl-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@H](Cc1ccc(C(F)(F)F)cc1)C(=O)NC[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C15H16F3N3O3/c1-8(6-9-2-4-10(5-3-9)15(16,17)18)12(22)19-7-11-13(23)21-14(24)20-11/h2-5,8,11H,6-7H2,1H3,(H,19,22)(H2,20,21,23,24)/t8-,11-/m1/s1 |
| InChIKey | LSFORXVEYLNQOW-LDYMZIIASA-N |
| XLogP | 1.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|